C21H24N2O6S — CID 130279492
N-hydroxy-3-[(5R)-3-[4-[4-(hydroxymethyl)-2-methylphenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methylsulfonylpropanamide (PubChem CID 130279492) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-hydroxy-3-[(5R)-3-[4-[4-(hydroxymethyl)-2-methylphenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methylsulfonylpropanamide.
| Compound Name | N-hydroxy-3-[(5R)-3-[4-[4-(hydroxymethyl)-2-methylphenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 130279492 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-hydroxy-3-[(5R)-3-[4-[4-(hydroxymethyl)-2-methylphenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methylsulfonylpropanamide |
| SMILES | Cc1cc(CO)ccc1-c1ccc(C2=NO[C@@H](CC(C(=O)NO)S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-13-9-14(12-24)3-8-18(13)15-4-6-16(7-5-15)19-10-17(29-23-19)11-20(21(25)22-26)30(2,27)28/h3-9,17,20,24,26H,10-12H2,1-2H3,(H,22,25)/t17-,20?/m1/s1 |
| InChIKey | VDWWYOUPMPIYFO-DIAVIDTQSA-N |
| XLogP | 1.96 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|