C25H25N3O2S — CID 144954600
5-(2-methoxy-4-pyridinyl)-3-phenyl-2-(4-sulfanylpentan-2-yl)quinazolin-4-one (PubChem CID 144954600) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 5-(2-methoxy-4-pyridinyl)-3-phenyl-2-(4-sulfanylpentan-2-yl)quinazolin-4-one.
| Compound Name | 5-(2-methoxy-4-pyridinyl)-3-phenyl-2-(4-sulfanylpentan-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 144954600 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 5-(2-methoxy-4-pyridinyl)-3-phenyl-2-(4-sulfanylpentan-2-yl)quinazolin-4-one |
| SMILES | COc1cc(-c2cccc3nc(C(C)CC(C)S)n(-c4ccccc4)c(=O)c23)ccn1 |
| InChI | InChI=1S/C25H25N3O2S/c1-16(14-17(2)31)24-27-21-11-7-10-20(18-12-13-26-22(15-18)30-3)23(21)25(29)28(24)19-8-5-4-6-9-19/h4-13,15-17,31H,14H2,1-3H3 |
| InChIKey | CKKBBFKRENYWFV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|