C8H13N3O2S2 — CID 14495500
1-(1,1-dioxothiolan-3-yl)-4,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 14495500) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 14495500 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4,5-dimethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | Cc1n(C2CCS(=O)(=O)C2)nc([S-])[n+]1C |
| InChI | InChI=1S/C8H13N3O2S2/c1-6-10(2)8(14)9-11(6)7-3-4-15(12,13)5-7/h7H,3-5H2,1-2H3 |
| InChIKey | OHSBUPNEZJKQPV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|