About 4-(6-methyldecoxy)phenol
4-(6-methyldecoxy)phenol (PubChem CID 14495583) has the molecular formula C17H28O2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-(6-methyldecoxy)phenol.
Molecular Properties
| Compound Name | 4-(6-methyldecoxy)phenol |
| PubChem CID | 14495583 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-(6-methyldecoxy)phenol |
| SMILES | CCCCC(C)CCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C17H28O2/c1-3-4-8-15(2)9-6-5-7-14-19-17-12-10-16(18)11-13-17/h10-13,15,18H,3-9,14H2,1-2H3 |
| InChIKey | HVQMGNYOMFEMRQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-methyldecoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyldecoxy)phenol?
The IUPAC name of 4-(6-methyldecoxy)phenol (CID 14495583) is 4-(6-methyldecoxy)phenol.
What is the SMILES notation for 4-(6-methyldecoxy)phenol?
The canonical SMILES for 4-(6-methyldecoxy)phenol is CCCCC(C)CCCCCOc1ccc(O)cc1.
What is the InChIKey of 4-(6-methyldecoxy)phenol?
The InChIKey is HVQMGNYOMFEMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-3-4-8-15(2)9-6-5-7-14-19-17-12-10-16(18)11-13-17/h10-13,15,18H,3-9,14H2,1-2H3.
What are the key properties of 4-(6-methyldecoxy)phenol?
4-(6-methyldecoxy)phenol has a molecular weight of 264.41 g/mol, XLogP of 5.16, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyldecoxy)phenol is sourced from PubChem (CID 14495583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).