About N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane
N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane (PubChem CID 144956349) has the molecular formula C18H23BrN2O
and a molecular weight of 363.30 g/mol. Its IUPAC name is N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane.
Molecular Properties
| Compound Name | N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane |
| PubChem CID | 144956349 |
| Molecular Formula | C18H23BrN2O |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane |
| SMILES | CC(=O)N(C)c1cnc2ccc(Br)cc2c1C.CC1CCC1 |
| InChI | InChI=1S/C13H13BrN2O.C5H10/c1-8-11-6-10(14)4-5-12(11)15-7-13(8)16(3)9(2)17;1-5-3-2-4-5/h4-7H,1-3H3;5H,2-4H2,1H3 |
| InChIKey | DIANTRVFIJTPAO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane?
The IUPAC name of N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane (CID 144956349) is N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane.
What is the SMILES notation for N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane?
The canonical SMILES for N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane is CC(=O)N(C)c1cnc2ccc(Br)cc2c1C.CC1CCC1.
What is the InChIKey of N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane?
The InChIKey is DIANTRVFIJTPAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O.C5H10/c1-8-11-6-10(14)4-5-12(11)15-7-13(8)16(3)9(2)17;1-5-3-2-4-5/h4-7H,1-3H3;5H,2-4H2,1H3.
What are the key properties of N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane?
N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane has a molecular weight of 363.30 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-4-methylquinolin-3-yl)-N-methylacetamide;methylcyclobutane is sourced from PubChem (CID 144956349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).