C19H13F4NO3S — CID 144956625
2-fluoro-4-[5-[1-[4-(trifluoromethoxy)phenoxy]ethyl]-1,2-thiazol-3-yl]benzaldehyde (PubChem CID 144956625) has the molecular formula C19H13F4NO3S and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-fluoro-4-[5-[1-[4-(trifluoromethoxy)phenoxy]ethyl]-1,2-thiazol-3-yl]benzaldehyde.
| Compound Name | 2-fluoro-4-[5-[1-[4-(trifluoromethoxy)phenoxy]ethyl]-1,2-thiazol-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 144956625 |
| Molecular Formula | C19H13F4NO3S |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-fluoro-4-[5-[1-[4-(trifluoromethoxy)phenoxy]ethyl]-1,2-thiazol-3-yl]benzaldehyde |
| SMILES | CC(Oc1ccc(OC(F)(F)F)cc1)c1cc(-c2ccc(C=O)c(F)c2)ns1 |
| InChI | InChI=1S/C19H13F4NO3S/c1-11(26-14-4-6-15(7-5-14)27-19(21,22)23)18-9-17(24-28-18)12-2-3-13(10-25)16(20)8-12/h2-11H,1H3 |
| InChIKey | WDOIXYSPSXYQIX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|