C19H33N5O2 — CID 144957423
2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;5-methyl-2-piperidin-4-ylpyridine (PubChem CID 144957423) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;5-methyl-2-piperidin-4-ylpyridine.
| Compound Name | 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;5-methyl-2-piperidin-4-ylpyridine |
|---|---|
| PubChem CID | 144957423 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;5-methyl-2-piperidin-4-ylpyridine |
| SMILES | CC(C)CC(C/C(N)=N/N)C(=O)O.Cc1ccc(C2CCNCC2)nc1 |
| InChI | InChI=1S/C11H16N2.C8H17N3O2/c1-9-2-3-11(13-8-9)10-4-6-12-7-5-10;1-5(2)3-6(8(12)13)4-7(9)11-10/h2-3,8,10,12H,4-7H2,1H3;5-6H,3-4,10H2,1-2H3,(H2,9,11)(H,12,13) |
| InChIKey | OFDZHDZPXMXAFO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|