C8H16N4O2 — CID 144957515
2-[2-amino-2-(iminohydrazinylidene)ethyl]-4-methylpentanoic acid (PubChem CID 144957515) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[2-amino-2-(iminohydrazinylidene)ethyl]-4-methylpentanoic acid.
| Compound Name | 2-[2-amino-2-(iminohydrazinylidene)ethyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 144957515 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[2-amino-2-(iminohydrazinylidene)ethyl]-4-methylpentanoic acid |
| SMILES | [H]/N=N/N=C(N)CC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C8H16N4O2/c1-5(2)3-6(8(13)14)4-7(9)11-12-10/h5-6H,3-4H2,1-2H3,(H,13,14)(H3,9,10,11) |
| InChIKey | CFMGGXQMSAPHRV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|