C22H40N4O2 — CID 144957512
2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;ethane;4-(4-methylphenyl)piperidine (PubChem CID 144957512) has the molecular formula C22H40N4O2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;ethane;4-(4-methylphenyl)piperidine.
| Compound Name | 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;ethane;4-(4-methylphenyl)piperidine |
|---|---|
| PubChem CID | 144957512 |
| Molecular Formula | C22H40N4O2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 2-[(2Z)-2-amino-2-hydrazinylideneethyl]-4-methylpentanoic acid;ethane;4-(4-methylphenyl)piperidine |
| SMILES | CC.CC(C)CC(C/C(N)=N/N)C(=O)O.Cc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C12H17N.C8H17N3O2.C2H6/c1-10-2-4-11(5-3-10)12-6-8-13-9-7-12;1-5(2)3-6(8(12)13)4-7(9)11-10;1-2/h2-5,12-13H,6-9H2,1H3;5-6H,3-4,10H2,1-2H3,(H2,9,11)(H,12,13);1-2H3 |
| InChIKey | RDCZREACYOPQBX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|