C25H21ClF3NO2S — CID 144958616
7-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-1-[3-(1,1-difluoroethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 144958616) has the molecular formula C25H21ClF3NO2S and a molecular weight of 491.96 g/mol. Its IUPAC name is 7-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-1-[3-(1,1-difluoroethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 7-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-1-[3-(1,1-difluoroethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 144958616 |
| Molecular Formula | C25H21ClF3NO2S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 7-[(E)-2-(2-chloro-6-fluorophenyl)ethenyl]-1-[3-(1,1-difluoroethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CC(F)(F)c1cccc(S(=O)(=O)N2CCCc3ccc(/C=C/c4c(F)cccc4Cl)cc32)c1 |
| InChI | InChI=1S/C25H21ClF3NO2S/c1-25(28,29)19-6-2-7-20(16-19)33(31,32)30-14-4-5-18-12-10-17(15-24(18)30)11-13-21-22(26)8-3-9-23(21)27/h2-3,6-13,15-16H,4-5,14H2,1H3/b13-11+ |
| InChIKey | MVSRNOCBKSLDQC-ACCUITESSA-N |
| XLogP | 6.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|