C18H19B2FN4OS — CID 144959475
CID 144959475 (PubChem CID 144959475) has the molecular formula C18H19B2FN4OS and a molecular weight of 380.07 g/mol.
| Compound Name | CID 144959475 |
|---|---|
| PubChem CID | 144959475 |
| Molecular Formula | C18H19B2FN4OS |
| Molecular Weight | 380.07 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | — |
| SMILES | [B]C([B])(CC1CCN(c2ccn3c(n2)nc2cccc(OC)c23)CC1)SF |
| InChI | InChI=1S/C18H19B2FN4OS/c1-26-14-4-2-3-13-16(14)25-10-7-15(23-17(25)22-13)24-8-5-12(6-9-24)11-18(19,20)27-21/h2-4,7,10,12H,5-6,8-9,11H2,1H3 |
| InChIKey | JLVTWMFXOIEMIX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.07 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|