C18H18F3IN4 — CID 177185512
7-iodo-2-[4-(3,3,3-trifluoropropyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole (PubChem CID 177185512) has the molecular formula C18H18F3IN4 and a molecular weight of 474.27 g/mol. Its IUPAC name is 7-iodo-2-[4-(3,3,3-trifluoropropyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole.
| Compound Name | 7-iodo-2-[4-(3,3,3-trifluoropropyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 177185512 |
| Molecular Formula | C18H18F3IN4 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 7-iodo-2-[4-(3,3,3-trifluoropropyl)piperidin-1-yl]pyrimido[1,2-a]benzimidazole |
| SMILES | FC(F)(F)CCC1CCN(c2ccn3c(n2)nc2ccc(I)cc23)CC1 |
| InChI | InChI=1S/C18H18F3IN4/c19-18(20,21)7-3-12-4-8-25(9-5-12)16-6-10-26-15-11-13(22)1-2-14(15)23-17(26)24-16/h1-2,6,10-12H,3-5,7-9H2 |
| InChIKey | NTXLGHOXFBMERO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|