C12H15N — CID 144961155
2-[(3E,5Z)-hepta-3,5-dien-2-yl]pyridine (PubChem CID 144961155) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-3,5-dien-2-yl]pyridine.
| Compound Name | 2-[(3E,5Z)-hepta-3,5-dien-2-yl]pyridine |
|---|---|
| PubChem CID | 144961155 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-[(3E,5Z)-hepta-3,5-dien-2-yl]pyridine |
| SMILES | C/C=C\C=C\C(C)c1ccccn1 |
| InChI | InChI=1S/C12H15N/c1-3-4-5-8-11(2)12-9-6-7-10-13-12/h3-11H,1-2H3/b4-3-,8-5+ |
| InChIKey | SJJBDIFSGMSEGJ-HMRFFJRGSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|