C24H27FO4 — CID 144962140
4-ethylbenzoic acid;(3S)-3-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one (PubChem CID 144962140) has the molecular formula C24H27FO4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-ethylbenzoic acid;(3S)-3-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one.
| Compound Name | 4-ethylbenzoic acid;(3S)-3-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 144962140 |
| Molecular Formula | C24H27FO4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-ethylbenzoic acid;(3S)-3-[(E)-4-(2-fluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one |
| SMILES | CCc1ccc(C(=O)O)cc1.O=C1CC[C@H](/C=C/C(O)Cc2ccccc2F)C1 |
| InChI | InChI=1S/C15H17FO2.C9H10O2/c16-15-4-2-1-3-12(15)10-14(18)8-6-11-5-7-13(17)9-11;1-2-7-3-5-8(6-4-7)9(10)11/h1-4,6,8,11,14,18H,5,7,9-10H2;3-6H,2H2,1H3,(H,10,11)/b8-6+;/t11-,14?;/m1./s1 |
| InChIKey | XKTNLIZELWRMSX-UUBPINNKSA-N |
| XLogP | 4.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|