C10H20N2O3 — CID 144964683
(5S)-5-acetamido-4-oxohexanamide;ethane (PubChem CID 144964683) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is (5S)-5-acetamido-4-oxohexanamide;ethane.
| Compound Name | (5S)-5-acetamido-4-oxohexanamide;ethane |
|---|---|
| PubChem CID | 144964683 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (5S)-5-acetamido-4-oxohexanamide;ethane |
| SMILES | CC.CC(=O)N[C@@H](C)C(=O)CCC(N)=O |
| InChI | InChI=1S/C8H14N2O3.C2H6/c1-5(10-6(2)11)7(12)3-4-8(9)13;1-2/h5H,3-4H2,1-2H3,(H2,9,13)(H,10,11);1-2H3/t5-;/m0./s1 |
| InChIKey | BSGRFBWZGDHGSA-JEDNCBNOSA-N |
| XLogP | 0.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |