C18H33N2O2 — CID 144965637
CID 144965637 (PubChem CID 144965637) has the molecular formula C18H33N2O2 and a molecular weight of 309.47 g/mol.
| Compound Name | CID 144965637 |
|---|---|
| PubChem CID | 144965637 |
| Molecular Formula | C18H33N2O2 |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | — |
| SMILES | CC.CC(=O)N[C@H](C(=O)N1CCCC1C)C1CC[C]=CCC1.[H][H] |
| InChI | InChI=1S/C16H25N2O2.C2H6.H2/c1-12-8-7-11-18(12)16(20)15(17-13(2)19)14-9-5-3-4-6-10-14;1-2;/h3,12,14-15H,5-11H2,1-2H3,(H,17,19);1-2H3;1H/t12?,14?,15-;;/m0../s1 |
| InChIKey | BLYZQRSILITURC-CNSDAELQSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |