C17H31N5O4 — CID 21158390
3-[1-acetamido-2-(2-methylpiperidin-1-yl)-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid (PubChem CID 21158390) has the molecular formula C17H31N5O4 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[1-acetamido-2-(2-methylpiperidin-1-yl)-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[1-acetamido-2-(2-methylpiperidin-1-yl)-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 21158390 |
| Molecular Formula | C17H31N5O4 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-[1-acetamido-2-(2-methylpiperidin-1-yl)-2-oxoethyl]-4-(diaminomethylamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)NC(C(=O)N1CCCCC1C)C1CC(C(=O)O)CC1NC(N)N |
| InChI | InChI=1S/C17H31N5O4/c1-9-5-3-4-6-22(9)15(24)14(20-10(2)23)12-7-11(16(25)26)8-13(12)21-17(18)19/h9,11-14,17,21H,3-8,18-19H2,1-2H3,(H,20,23)(H,25,26) |
| InChIKey | BEZDHFYVVXOHRM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|