C36H34N2O4 — CID 144967866
methyl N-[4-[[methoxy-(2-phenylmethoxyphenyl)methylidene]amino]cyclohexa-1,3-dien-1-yl]-2-phenylmethoxybenzenecarboximidate (PubChem CID 144967866) has the molecular formula C36H34N2O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is methyl N-[4-[[methoxy-(2-phenylmethoxyphenyl)methylidene]amino]cyclohexa-1,3-dien-1-yl]-2-phenylmethoxybenzenecarboximidate.
| Compound Name | methyl N-[4-[[methoxy-(2-phenylmethoxyphenyl)methylidene]amino]cyclohexa-1,3-dien-1-yl]-2-phenylmethoxybenzenecarboximidate |
|---|---|
| PubChem CID | 144967866 |
| Molecular Formula | C36H34N2O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | methyl N-[4-[[methoxy-(2-phenylmethoxyphenyl)methylidene]amino]cyclohexa-1,3-dien-1-yl]-2-phenylmethoxybenzenecarboximidate |
| SMILES | CO/C(=N\C1=CC=C(/N=C(\OC)c2ccccc2OCc2ccccc2)CC1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H34N2O4/c1-39-35(31-17-9-11-19-33(31)41-25-27-13-5-3-6-14-27)37-29-21-23-30(24-22-29)38-36(40-2)32-18-10-12-20-34(32)42-26-28-15-7-4-8-16-28/h3-21,23H,22,24-26H2,1-2H3/b37-35-,38-36- |
| InChIKey | OMRJMOYLVPYAMT-JXPYRENWSA-N |
| XLogP | 7.89 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|