C23H36N4 — CID 144968745
4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane (PubChem CID 144968745) has the molecular formula C23H36N4 and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane.
| Compound Name | 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane |
|---|---|
| PubChem CID | 144968745 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane |
| SMILES | CC.CN(CCCC1CCN(c2ccc(N)cc2)CC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H30N4.C2H6/c1-24(20-8-4-18(22)5-9-20)14-2-3-17-12-15-25(16-13-17)21-10-6-19(23)7-11-21;1-2/h4-11,17H,2-3,12-16,22-23H2,1H3;1-2H3 |
| InChIKey | GELRQAKNCSUZBB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|