About 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane
4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane (PubChem CID 144968745) has the molecular formula C23H36N4
and a molecular weight of 368.57 g/mol. Its IUPAC name is 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane.
Molecular Properties
| Compound Name | 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane |
| PubChem CID | 144968745 |
| Molecular Formula | C23H36N4 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane |
| SMILES | CC.CN(CCCC1CCN(c2ccc(N)cc2)CC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H30N4.C2H6/c1-24(20-8-4-18(22)5-9-20)14-2-3-17-12-15-25(16-13-17)21-10-6-19(23)7-11-21;1-2/h4-11,17H,2-3,12-16,22-23H2,1H3;1-2H3 |
| InChIKey | GELRQAKNCSUZBB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane?
The IUPAC name of 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane (CID 144968745) is 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane.
What is the SMILES notation for 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane?
The canonical SMILES for 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane is CC.CN(CCCC1CCN(c2ccc(N)cc2)CC1)c1ccc(N)cc1.
What is the InChIKey of 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane?
The InChIKey is GELRQAKNCSUZBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4.C2H6/c1-24(20-8-4-18(22)5-9-20)14-2-3-17-12-15-25(16-13-17)21-10-6-19(23)7-11-21;1-2/h4-11,17H,2-3,12-16,22-23H2,1H3;1-2H3.
What are the key properties of 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane?
4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane has a molecular weight of 368.57 g/mol, XLogP of 5.01, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[3-[1-(4-aminophenyl)piperidin-4-yl]propyl]-4-N-methylbenzene-1,4-diamine;ethane is sourced from PubChem (CID 144968745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).