C25H39N3 — CID 145373708
N,4-dimethyl-N-[[1-(4-methylphenyl)piperidin-4-yl]methyl]aniline;methanamine;prop-1-ene (PubChem CID 145373708) has the molecular formula C25H39N3 and a molecular weight of 381.61 g/mol. Its IUPAC name is N,4-dimethyl-N-[[1-(4-methylphenyl)piperidin-4-yl]methyl]aniline;methanamine;prop-1-ene.
| Compound Name | N,4-dimethyl-N-[[1-(4-methylphenyl)piperidin-4-yl]methyl]aniline;methanamine;prop-1-ene |
|---|---|
| PubChem CID | 145373708 |
| Molecular Formula | C25H39N3 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.31 |
| IUPAC Name | N,4-dimethyl-N-[[1-(4-methylphenyl)piperidin-4-yl]methyl]aniline;methanamine;prop-1-ene |
| SMILES | C=CC.CN.Cc1ccc(N(C)CC2CCN(c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H28N2.C3H6.CH5N/c1-17-4-8-20(9-5-17)22(3)16-19-12-14-23(15-13-19)21-10-6-18(2)7-11-21;1-3-2;1-2/h4-11,19H,12-16H2,1-3H3;3H,1H2,2H3;2H2,1H3 |
| InChIKey | HSJSQPBZKMODKX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|