C27H40N4O2 — CID 144968747
tert-butyl N-(4-amino-3-methylphenyl)-N-[2-[1-[2-methyl-4-(methylamino)phenyl]piperidin-4-yl]ethyl]carbamate (PubChem CID 144968747) has the molecular formula C27H40N4O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is tert-butyl N-(4-amino-3-methylphenyl)-N-[2-[1-[2-methyl-4-(methylamino)phenyl]piperidin-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-(4-amino-3-methylphenyl)-N-[2-[1-[2-methyl-4-(methylamino)phenyl]piperidin-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 144968747 |
| Molecular Formula | C27H40N4O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | tert-butyl N-(4-amino-3-methylphenyl)-N-[2-[1-[2-methyl-4-(methylamino)phenyl]piperidin-4-yl]ethyl]carbamate |
| SMILES | CNc1ccc(N2CCC(CCN(C(=O)OC(C)(C)C)c3ccc(N)c(C)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C27H40N4O2/c1-19-18-23(8-9-24(19)28)31(26(32)33-27(3,4)5)16-13-21-11-14-30(15-12-21)25-10-7-22(29-6)17-20(25)2/h7-10,17-18,21,29H,11-16,28H2,1-6H3 |
| InChIKey | LDIWRRIDROYUAE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|