C23H40N2O2 — CID 144971331
2-butyl-9-[(Z)-3-ethenylpent-3-enyl]-4-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;ethene (PubChem CID 144971331) has the molecular formula C23H40N2O2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2-butyl-9-[(Z)-3-ethenylpent-3-enyl]-4-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;ethene.
| Compound Name | 2-butyl-9-[(Z)-3-ethenylpent-3-enyl]-4-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;ethene |
|---|---|
| PubChem CID | 144971331 |
| Molecular Formula | C23H40N2O2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 2-butyl-9-[(Z)-3-ethenylpent-3-enyl]-4-ethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;ethene |
| SMILES | C=C.C=C/C(=C\C)CCN1CCC2(CC1)CN(CC)C(=O)C(CCCC)O2 |
| InChI | InChI=1S/C21H36N2O2.C2H4/c1-5-9-10-19-20(24)23(8-4)17-21(25-19)12-15-22(16-13-21)14-11-18(6-2)7-3;1-2/h6-7,19H,2,5,8-17H2,1,3-4H3;1-2H2/b18-7+; |
| InChIKey | AVAMBBCNBRPFQH-CWSPIBBISA-N |
| XLogP | 4.58 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|