C17H28O5 — CID 144971658
(6-hydroxy-6-methoxyhexyl) 4-propoxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 144971658) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (6-hydroxy-6-methoxyhexyl) 4-propoxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (6-hydroxy-6-methoxyhexyl) 4-propoxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 144971658 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (6-hydroxy-6-methoxyhexyl) 4-propoxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCCOC1=CC=C(C(=O)OCCCCCC(O)OC)CC1 |
| InChI | InChI=1S/C17H28O5/c1-3-12-21-15-10-8-14(9-11-15)17(19)22-13-6-4-5-7-16(18)20-2/h8,10,16,18H,3-7,9,11-13H2,1-2H3 |
| InChIKey | TVCQBOXEVKUCHB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|