About ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate
ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate (PubChem CID 143820185) has the molecular formula C23H40O6
and a molecular weight of 412.57 g/mol. Its IUPAC name is ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate |
| PubChem CID | 143820185 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate |
| SMILES | CCOC(=O)CCC1=C(CCCCCCO)CCC=C1OCCCC(O)OCC |
| InChI | InChI=1S/C23H40O6/c1-3-27-22(25)14-10-18-29-21-13-9-12-19(11-7-5-6-8-17-24)20(21)15-16-23(26)28-4-2/h13,22,24-25H,3-12,14-18H2,1-2H3 |
| InChIKey | JXOAXERVRIECAH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate?
The IUPAC name of ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate (CID 143820185) is ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate.
What is the SMILES notation for ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate?
The canonical SMILES for ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate is CCOC(=O)CCC1=C(CCCCCCO)CCC=C1OCCCC(O)OCC.
What is the InChIKey of ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate?
The InChIKey is JXOAXERVRIECAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O6/c1-3-27-22(25)14-10-18-29-21-13-9-12-19(11-7-5-6-8-17-24)20(21)15-16-23(26)28-4-2/h13,22,24-25H,3-12,14-18H2,1-2H3.
What are the key properties of ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate?
ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate has a molecular weight of 412.57 g/mol, XLogP of 4.40, 17 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[6-(4-ethoxy-4-hydroxybutoxy)-2-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]propanoate is sourced from PubChem (CID 143820185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).