About ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate
ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate (PubChem CID 70998677) has the molecular formula C23H38O6
and a molecular weight of 410.55 g/mol. Its IUPAC name is ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate.
Molecular Properties
| Compound Name | ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate |
| PubChem CID | 70998677 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOC1=CCCC(CCCCCCO)=C1CCC(=O)OCC |
| InChI | InChI=1S/C23H38O6/c1-3-27-22(25)14-10-18-29-21-13-9-12-19(11-7-5-6-8-17-24)20(21)15-16-23(26)28-4-2/h13,24H,3-12,14-18H2,1-2H3 |
| InChIKey | WHRIURHQMCLRHI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate?
The IUPAC name of ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate (CID 70998677) is ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate.
What is the SMILES notation for ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate?
The canonical SMILES for ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate is CCOC(=O)CCCOC1=CCCC(CCCCCCO)=C1CCC(=O)OCC.
What is the InChIKey of ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate?
The InChIKey is WHRIURHQMCLRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38O6/c1-3-27-22(25)14-10-18-29-21-13-9-12-19(11-7-5-6-8-17-24)20(21)15-16-23(26)28-4-2/h13,24H,3-12,14-18H2,1-2H3.
What are the key properties of ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate?
ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate has a molecular weight of 410.55 g/mol, XLogP of 4.61, 16 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[6-(3-ethoxy-3-oxopropyl)-5-(6-hydroxyhexyl)cyclohexa-1,5-dien-1-yl]oxybutanoate is sourced from PubChem (CID 70998677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).