C15H25FS — CID 144971730
(3Z,5Z)-7-fluoro-2-heptylsulfanyl-5-methylhepta-1,3,5-triene (PubChem CID 144971730) has the molecular formula C15H25FS and a molecular weight of 256.43 g/mol. Its IUPAC name is (3Z,5Z)-7-fluoro-2-heptylsulfanyl-5-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-7-fluoro-2-heptylsulfanyl-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144971730 |
| Molecular Formula | C15H25FS |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (3Z,5Z)-7-fluoro-2-heptylsulfanyl-5-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C/CF)SCCCCCCC |
| InChI | InChI=1S/C15H25FS/c1-4-5-6-7-8-13-17-15(3)10-9-14(2)11-12-16/h9-11H,3-8,12-13H2,1-2H3/b10-9-,14-11- |
| InChIKey | KLOQCBDNBQABNN-WEJYHURQSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|