C27H35N5O5S — CID 144975537
1-[4-[2-[[2-(4-ethylidenecyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]imidazolidine-2,4-dione (PubChem CID 144975537) has the molecular formula C27H35N5O5S and a molecular weight of 541.67 g/mol. Its IUPAC name is 1-[4-[2-[[2-(4-ethylidenecyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-[2-[[2-(4-ethylidenecyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 144975537 |
| Molecular Formula | C27H35N5O5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 1-[4-[2-[[2-(4-ethylidenecyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3-methylphenyl]imidazolidine-2,4-dione |
| SMILES | CC=C1CCC(C2=NC3(CCN(S(=O)(=O)CCc4ccc(N5CC(=O)NC5=O)cc4C)CC3)C(=O)N2)CC1 |
| InChI | InChI=1S/C27H35N5O5S/c1-3-19-4-6-21(7-5-19)24-29-25(34)27(30-24)11-13-31(14-12-27)38(36,37)15-10-20-8-9-22(16-18(20)2)32-17-23(33)28-26(32)35/h3,8-9,16,21H,4-7,10-15,17H2,1-2H3,(H,28,33,35)(H,29,30,34)/b19-3- |
| InChIKey | UCVZPIKGLVSKIA-OQOIWIOPSA-N |
| XLogP | 2.42 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|