C26H35F3N4O4S — CID 66816411
N-[3-methyl-4-[2-[[4-oxo-2-[4-(2,2,2-trifluoroethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]acetamide (PubChem CID 66816411) has the molecular formula C26H35F3N4O4S and a molecular weight of 556.65 g/mol. Its IUPAC name is N-[3-methyl-4-[2-[[4-oxo-2-[4-(2,2,2-trifluoroethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]acetamide.
| Compound Name | N-[3-methyl-4-[2-[[4-oxo-2-[4-(2,2,2-trifluoroethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 66816411 |
| Molecular Formula | C26H35F3N4O4S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | N-[3-methyl-4-[2-[[4-oxo-2-[4-(2,2,2-trifluoroethyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CCS(=O)(=O)N2CCC3(CC2)N=C(C2CCC(CC(F)(F)F)CC2)NC3=O)c(C)c1 |
| InChI | InChI=1S/C26H35F3N4O4S/c1-17-15-22(30-18(2)34)8-7-20(17)9-14-38(36,37)33-12-10-25(11-13-33)24(35)31-23(32-25)21-5-3-19(4-6-21)16-26(27,28)29/h7-8,15,19,21H,3-6,9-14,16H2,1-2H3,(H,30,34)(H,31,32,35) |
| InChIKey | HCWYAYMXSRYGPV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |