C31H45F3N4O5S — CID 66817049
tert-butyl N-[[3-methyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]carbamate (PubChem CID 66817049) has the molecular formula C31H45F3N4O5S and a molecular weight of 642.79 g/mol. Its IUPAC name is tert-butyl N-[[3-methyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-methyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 66817049 |
| Molecular Formula | C31H45F3N4O5S |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | tert-butyl N-[[3-methyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]methyl]carbamate |
| SMILES | Cc1cc(CNC(=O)OC(C)(C)C)ccc1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C31H45F3N4O5S/c1-21-19-23(20-35-28(40)43-29(2,3)4)7-8-24(21)12-18-44(41,42)38-16-14-30(15-17-38)27(39)36-26(37-30)25-9-5-22(6-10-25)11-13-31(32,33)34/h7-8,19,22,25H,5-6,9-18,20H2,1-4H3,(H,35,40)(H,36,37,39) |
| InChIKey | AYZQCSGYDNHWRL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |