C27H37F3N4O3S — CID 66816393
8-[(E)-2-[4-(aminomethyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66816393) has the molecular formula C27H37F3N4O3S and a molecular weight of 554.68 g/mol. Its IUPAC name is 8-[(E)-2-[4-(aminomethyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[(E)-2-[4-(aminomethyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66816393 |
| Molecular Formula | C27H37F3N4O3S |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 8-[(E)-2-[4-(aminomethyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(CN)cc(C)c1/C=C/S(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C27H37F3N4O3S/c1-18-15-21(17-31)16-19(2)23(18)8-14-38(36,37)34-12-10-26(11-13-34)25(35)32-24(33-26)22-5-3-20(4-6-22)7-9-27(28,29)30/h8,14-16,20,22H,3-7,9-13,17,31H2,1-2H3,(H,32,33,35)/b14-8+ |
| InChIKey | NREFYCCHHWOANF-RIYZIHGNSA-N |
| XLogP | 4.57 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |