C28H37N5O5S — CID 66815997
1-[3,5-dimethyl-4-[2-[[2-(4-methylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 66815997) has the molecular formula C28H37N5O5S and a molecular weight of 555.70 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[2-[[2-(4-methylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3,5-dimethyl-4-[2-[[2-(4-methylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 66815997 |
| Molecular Formula | C28H37N5O5S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 1-[3,5-dimethyl-4-[2-[[2-(4-methylcyclohexyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc(N2CCC(=O)NC2=O)cc(C)c1C=CS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(C)CC1)NC2=O |
| InChI | InChI=1S/C28H37N5O5S/c1-18-4-6-21(7-5-18)25-30-26(35)28(31-25)10-13-32(14-11-28)39(37,38)15-9-23-19(2)16-22(17-20(23)3)33-12-8-24(34)29-27(33)36/h9,15-18,21H,4-8,10-14H2,1-3H3,(H,29,34,36)(H,30,31,35) |
| InChIKey | PWGSJRUAXILCHZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |