C30H44F3N5O4S — CID 66817964
N,N',N',3,5-pentamethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzohydrazide (PubChem CID 66817964) has the molecular formula C30H44F3N5O4S and a molecular weight of 627.77 g/mol. Its IUPAC name is N,N',N',3,5-pentamethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzohydrazide.
| Compound Name | N,N',N',3,5-pentamethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 66817964 |
| Molecular Formula | C30H44F3N5O4S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | N,N',N',3,5-pentamethyl-4-[2-[[4-oxo-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]benzohydrazide |
| SMILES | Cc1cc(C(=O)N(C)N(C)C)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C30H44F3N5O4S/c1-20-18-24(27(39)37(5)36(3)4)19-21(2)25(20)11-17-43(41,42)38-15-13-29(14-16-38)28(40)34-26(35-29)23-8-6-22(7-9-23)10-12-30(31,32)33/h18-19,22-23H,6-17H2,1-5H3,(H,34,35,40) |
| InChIKey | GEBPVKXFLMLPJS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|