C29H42F3N3O6S — CID 66817665
8-[2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 66817665) has the molecular formula C29H42F3N3O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is 8-[2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 66817665 |
| Molecular Formula | C29H42F3N3O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 8-[2-[4-(2,3-dihydroxypropoxy)-2,6-dimethylphenyl]ethylsulfonyl]-2-[4-(3,3,3-trifluoropropyl)cyclohexyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(OCC(O)CO)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(C1CCC(CCC(F)(F)F)CC1)NC2=O |
| InChI | InChI=1S/C29H42F3N3O6S/c1-19-15-24(41-18-23(37)17-36)16-20(2)25(19)8-14-42(39,40)35-12-10-28(11-13-35)27(38)33-26(34-28)22-5-3-21(4-6-22)7-9-29(30,31)32/h15-16,21-23,36-37H,3-14,17-18H2,1-2H3,(H,33,34,38) |
| InChIKey | IZDJLWRINWZRTJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |