C28H25N3O3 — CID 144977335
3-[(2E,4E)-4-[1-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]hexa-2,4-dien-2-yl]benzoic acid (PubChem CID 144977335) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[(2E,4E)-4-[1-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]hexa-2,4-dien-2-yl]benzoic acid.
| Compound Name | 3-[(2E,4E)-4-[1-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]hexa-2,4-dien-2-yl]benzoic acid |
|---|---|
| PubChem CID | 144977335 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-[(2E,4E)-4-[1-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]hexa-2,4-dien-2-yl]benzoic acid |
| SMILES | C/C=C(\C=C(/C)c1cccc(C(=O)O)c1)c1nc(-c2ccccc2)n(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C28H25N3O3/c1-4-20(17-19(2)22-11-8-12-23(18-22)28(32)33)26-29-27(21-9-6-5-7-10-21)31(30-26)24-13-15-25(34-3)16-14-24/h4-18H,1-3H3,(H,32,33)/b19-17+,20-4+ |
| InChIKey | JMOKAXQZQNGUJU-MFKRZJOXSA-N |
| XLogP | 6.15 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|