C18H25N3O2S — CID 144977854
S-anilinothiohydroxylamine;5-[(2,2-dimethylcyclopropyl)methoxy]-2-methoxypyridine (PubChem CID 144977854) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is S-anilinothiohydroxylamine;5-[(2,2-dimethylcyclopropyl)methoxy]-2-methoxypyridine.
| Compound Name | S-anilinothiohydroxylamine;5-[(2,2-dimethylcyclopropyl)methoxy]-2-methoxypyridine |
|---|---|
| PubChem CID | 144977854 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | S-anilinothiohydroxylamine;5-[(2,2-dimethylcyclopropyl)methoxy]-2-methoxypyridine |
| SMILES | COc1ccc(OCC2CC2(C)C)cn1.NSNc1ccccc1 |
| InChI | InChI=1S/C12H17NO2.C6H8N2S/c1-12(2)6-9(12)8-15-10-4-5-11(14-3)13-7-10;7-9-8-6-4-2-1-3-5-6/h4-5,7,9H,6,8H2,1-3H3;1-5,8H,7H2 |
| InChIKey | OQTKJTHUNRXPGM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|