C32H48N6O5 — CID 144981563
(Z)-2-[1-(butylamino)ethenyl]but-2-enenitrile;N-[3-methoxy-1-[[2-[(4-methylphenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide;propane (PubChem CID 144981563) has the molecular formula C32H48N6O5 and a molecular weight of 596.77 g/mol. Its IUPAC name is (Z)-2-[1-(butylamino)ethenyl]but-2-enenitrile;N-[3-methoxy-1-[[2-[(4-methylphenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide;propane.
| Compound Name | (Z)-2-[1-(butylamino)ethenyl]but-2-enenitrile;N-[3-methoxy-1-[[2-[(4-methylphenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide;propane |
|---|---|
| PubChem CID | 144981563 |
| Molecular Formula | C32H48N6O5 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | (Z)-2-[1-(butylamino)ethenyl]but-2-enenitrile;N-[3-methoxy-1-[[2-[(4-methylphenyl)methylamino]-2-oxoethyl]amino]-1-oxopropan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide;propane |
| SMILES | C=C(NCCCC)/C(C#N)=C/C.CCC.COCC(NC(=O)c1cc(C)on1)C(=O)NCC(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C19H24N4O5.C10H16N2.C3H8/c1-12-4-6-14(7-5-12)9-20-17(24)10-21-18(25)16(11-27-3)22-19(26)15-8-13(2)28-23-15;1-4-6-7-12-9(3)10(5-2)8-11;1-3-2/h4-8,16H,9-11H2,1-3H3,(H,20,24)(H,21,25)(H,22,26);5,12H,3-4,6-7H2,1-2H3;3H2,1-2H3/b;10-5+; |
| InChIKey | UPZHMGMHGPPOBW-ATWZUJJXSA-N |
| XLogP | 4.24 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|