C9H11N3O4 — CID 144981917
5-[5-(nitrosomethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione (PubChem CID 144981917) has the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. Its IUPAC name is 5-[5-(nitrosomethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[5-(nitrosomethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 144981917 |
| Molecular Formula | C9H11N3O4 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 5-[5-(nitrosomethyl)oxolan-2-yl]-1H-pyrimidine-2,4-dione |
| SMILES | O=NCC1CCC(c2c[nH]c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H11N3O4/c13-8-6(4-10-9(14)12-8)7-2-1-5(16-7)3-11-15/h4-5,7H,1-3H2,(H2,10,12,13,14) |
| InChIKey | NPVUAXVCVOGEEJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |