C15H22N4O2 — CID 144982738
ethyl 5-(1-ethanimidoyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-1-methylpyrazole-3-carboxylate (PubChem CID 144982738) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is ethyl 5-(1-ethanimidoyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-1-methylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(1-ethanimidoyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 144982738 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl 5-(1-ethanimidoyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)-1-methylpyrazole-3-carboxylate |
| SMILES | [H]/N=C(\C)N1CCC(C)=C(c2cc(C(=O)OCC)nn2C)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-5-21-15(20)13-8-14(18(4)17-13)12-9-19(11(3)16)7-6-10(12)2/h8,16H,5-7,9H2,1-4H3/b16-11+ |
| InChIKey | QEMUJPWGFCTEDO-LFIBNONCSA-N |
| XLogP | 2.07 |
| TPSA | 71.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|