C20H24N2O3S — CID 144982871
1-methyl-2-(oxolan-2-ylmethylamino)-10-(sulfanylmethoxy)-6,7-dihydrobenzo[a]quinolizin-4-one (PubChem CID 144982871) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-methyl-2-(oxolan-2-ylmethylamino)-10-(sulfanylmethoxy)-6,7-dihydrobenzo[a]quinolizin-4-one.
| Compound Name | 1-methyl-2-(oxolan-2-ylmethylamino)-10-(sulfanylmethoxy)-6,7-dihydrobenzo[a]quinolizin-4-one |
|---|---|
| PubChem CID | 144982871 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-methyl-2-(oxolan-2-ylmethylamino)-10-(sulfanylmethoxy)-6,7-dihydrobenzo[a]quinolizin-4-one |
| SMILES | Cc1c(NCC2CCCO2)cc(=O)n2c1-c1cc(OCS)ccc1CC2 |
| InChI | InChI=1S/C20H24N2O3S/c1-13-18(21-11-16-3-2-8-24-16)10-19(23)22-7-6-14-4-5-15(25-12-26)9-17(14)20(13)22/h4-5,9-10,16,21,26H,2-3,6-8,11-12H2,1H3 |
| InChIKey | PWPINGDSQDZLOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|