C26H45NO2 — CID 144982998
17-(6-amino-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 144982998) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 17-(6-amino-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | 17-(6-amino-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 144982998 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | 17-(6-amino-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC(CN)CCCCC1C(O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H45NO2/c1-17(16-27)6-4-5-7-22-24(29)15-23-20-9-8-18-14-19(28)10-12-25(18,2)21(20)11-13-26(22,23)3/h8,17,19-24,28-29H,4-7,9-16,27H2,1-3H3 |
| InChIKey | MBBUXINWTBJDCI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|