C24H35IO2 — CID 144983552
[(10R,13S)-17-(1-iodoethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate (PubChem CID 144983552) has the molecular formula C24H35IO2 and a molecular weight of 482.45 g/mol. Its IUPAC name is [(10R,13S)-17-(1-iodoethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate.
| Compound Name | [(10R,13S)-17-(1-iodoethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 144983552 |
| Molecular Formula | C24H35IO2 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(10R,13S)-17-(1-iodoethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CC[C@@]2(C)C(=CCC3C4CCC(C(C)I)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C24H35IO2/c1-5-22(26)27-17-10-12-23(3)16(14-17)6-7-18-20-9-8-19(15(2)25)24(20,4)13-11-21(18)23/h5-6,15,17-21H,1,7-14H2,2-4H3/t15?,17?,18?,19?,20?,21?,23-,24+/m0/s1 |
| InChIKey | PXZNZSLOXYIJRM-RVEHSQRDSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|