C29H44O4 — CID 10950549
[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-[(1S)-1-[(2S,3R)-3-(2-methylpropanoyl)oxiran-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10950549) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-[(1S)-1-[(2S,3R)-3-(2-methylpropanoyl)oxiran-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-[(1S)-1-[(2S,3R)-3-(2-methylpropanoyl)oxiran-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10950549 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-[(1S)-1-[(2S,3R)-3-(2-methylpropanoyl)oxiran-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)[C@@H]5O[C@H]5C(=O)C(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H44O4/c1-16(2)25(31)27-26(33-27)17(3)22-9-10-23-21-8-7-19-15-20(32-18(4)30)11-13-28(19,5)24(21)12-14-29(22,23)6/h7,16-17,20-24,26-27H,8-15H2,1-6H3/t17-,20?,21-,22+,23-,24-,26-,27-,28-,29+/m0/s1 |
| InChIKey | WMCPOBMPHGJEJM-XZJKIZIFSA-N |
| XLogP | 6.13 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|