C28H45NO3 — CID 4043315
[17-[1-(diethylamino)-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4043315) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is [17-[1-(diethylamino)-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[1-(diethylamino)-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4043315 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | [17-[1-(diethylamino)-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCN(CC)C(=O)C(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H45NO3/c1-7-29(8-2)26(31)18(3)23-11-12-24-22-10-9-20-17-21(32-19(4)30)13-15-27(20,5)25(22)14-16-28(23,24)6/h9,18,21-25H,7-8,10-17H2,1-6H3 |
| InChIKey | WUOAVHYTSXAIAA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|