C31H48Br2O2 — CID 5358085
[17-[(Z)-3,4-dibromo-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 5358085) has the molecular formula C31H48Br2O2 and a molecular weight of 612.53 g/mol. Its IUPAC name is [17-[(Z)-3,4-dibromo-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[(Z)-3,4-dibromo-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 5358085 |
| Molecular Formula | C31H48Br2O2 |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | [17-[(Z)-3,4-dibromo-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCC(/C(Br)=C(/Br)C(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C31H48Br2O2/c1-8-23(18(2)3)29(33)28(32)19(4)25-11-12-26-24-10-9-21-17-22(35-20(5)34)13-15-30(21,6)27(24)14-16-31(25,26)7/h9,18-19,22-27H,8,10-17H2,1-7H3/b29-28- |
| InChIKey | KWPFHFMDXUEMSP-ZIADKAODSA-N |
| XLogP | 9.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|