C28H43Cl2NO3 — CID 4255032
[17-[1-[bis(2-chloroethyl)amino]-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4255032) has the molecular formula C28H43Cl2NO3 and a molecular weight of 512.56 g/mol. Its IUPAC name is [17-[1-[bis(2-chloroethyl)amino]-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-[1-[bis(2-chloroethyl)amino]-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4255032 |
| Molecular Formula | C28H43Cl2NO3 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | [17-[1-[bis(2-chloroethyl)amino]-1-oxopropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)C(=O)N(CCCl)CCCl)CCC32)C1 |
| InChI | InChI=1S/C28H43Cl2NO3/c1-18(26(33)31(15-13-29)16-14-30)23-7-8-24-22-6-5-20-17-21(34-19(2)32)9-11-27(20,3)25(22)10-12-28(23,24)4/h5,18,21-25H,6-17H2,1-4H3 |
| InChIKey | GUCZUMLMUMDVHF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|