About 6-isothiocyanatohexyl propanoate
6-isothiocyanatohexyl propanoate (PubChem CID 144983698) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is 6-isothiocyanatohexyl propanoate.
Molecular Properties
| Compound Name | 6-isothiocyanatohexyl propanoate |
| PubChem CID | 144983698 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 6-isothiocyanatohexyl propanoate |
| SMILES | CCC(=O)OCCCCCCN=C=S |
| InChI | InChI=1S/C10H17NO2S/c1-2-10(12)13-8-6-4-3-5-7-11-9-14/h2-8H2,1H3 |
| InChIKey | VVKVPQHOOMFTPJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-isothiocyanatohexyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isothiocyanatohexyl propanoate?
The IUPAC name of 6-isothiocyanatohexyl propanoate (CID 144983698) is 6-isothiocyanatohexyl propanoate.
What is the SMILES notation for 6-isothiocyanatohexyl propanoate?
The canonical SMILES for 6-isothiocyanatohexyl propanoate is CCC(=O)OCCCCCCN=C=S.
What is the InChIKey of 6-isothiocyanatohexyl propanoate?
The InChIKey is VVKVPQHOOMFTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-2-10(12)13-8-6-4-3-5-7-11-9-14/h2-8H2,1H3.
What are the key properties of 6-isothiocyanatohexyl propanoate?
6-isothiocyanatohexyl propanoate has a molecular weight of 215.32 g/mol, XLogP of 2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isothiocyanatohexyl propanoate is sourced from PubChem (CID 144983698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).