C51H39N3 — CID 144984911
ethane;21-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]cyclohexa-1,3-dien-5-yn-1-yl]-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,7,11,13,15,17,19,21-nonaene (PubChem CID 144984911) has the molecular formula C51H39N3 and a molecular weight of 693.89 g/mol. Its IUPAC name is ethane;21-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]cyclohexa-1,3-dien-5-yn-1-yl]-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,7,11,13,15,17,19,21-nonaene.
| Compound Name | ethane;21-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]cyclohexa-1,3-dien-5-yn-1-yl]-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,7,11,13,15,17,19,21-nonaene |
|---|---|
| PubChem CID | 144984911 |
| Molecular Formula | C51H39N3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | ethane;21-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]cyclohexa-1,3-dien-5-yn-1-yl]-22-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,3,7,11,13,15,17,19,21-nonaene |
| SMILES | CC.c1c(-c2cc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccccc3)n2)ccc(-c2nc3c4c(c5c(c3c3ccccc23)C=CCC5)CCC=C4)c#1 |
| InChI | InChI=1S/C49H33N3.C2H6/c1-3-13-32(14-4-1)33-23-25-34(26-24-33)44-31-45(51-49(50-44)37-15-5-2-6-16-37)35-27-29-36(30-28-35)47-43-22-12-10-20-41(43)46-40-19-9-7-17-38(40)39-18-8-11-21-42(39)48(46)52-47;1-2/h1-6,9-16,19-27,29,31H,7-8,17-18H2;1-2H3 |
| InChIKey | JRSUBWXHFGBAJG-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|