C21H27NO4 — CID 144985214
tert-butyl formate;6,7-dihydro-5H-pyrrolizin-3-yl-[4-(2-hydroxyethyl)phenyl]methanone (PubChem CID 144985214) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl formate;6,7-dihydro-5H-pyrrolizin-3-yl-[4-(2-hydroxyethyl)phenyl]methanone.
| Compound Name | tert-butyl formate;6,7-dihydro-5H-pyrrolizin-3-yl-[4-(2-hydroxyethyl)phenyl]methanone |
|---|---|
| PubChem CID | 144985214 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl formate;6,7-dihydro-5H-pyrrolizin-3-yl-[4-(2-hydroxyethyl)phenyl]methanone |
| SMILES | CC(C)(C)OC=O.O=C(c1ccc(CCO)cc1)c1ccc2n1CCC2 |
| InChI | InChI=1S/C16H17NO2.C5H10O2/c18-11-9-12-3-5-13(6-4-12)16(19)15-8-7-14-2-1-10-17(14)15;1-5(2,3)7-4-6/h3-8,18H,1-2,9-11H2;4H,1-3H3 |
| InChIKey | HWBTUSPXGSVNMA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|