About 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane
6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane (PubChem CID 144986620) has the molecular formula C16H21N3O3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane.
Molecular Properties
| Compound Name | 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane |
| PubChem CID | 144986620 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane |
| SMILES | C1CCOCC1.Cc1csc(NC(=O)c2cc(=O)cc(C)[nH]2)n1 |
| InChI | InChI=1S/C11H11N3O2S.C5H10O/c1-6-3-8(15)4-9(12-6)10(16)14-11-13-7(2)5-17-11;1-2-4-6-5-3-1/h3-5H,1-2H3,(H,12,15)(H,13,14,16);1-5H2 |
| InChIKey | KPYJHRPKQYLQOC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane?
The IUPAC name of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane (CID 144986620) is 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane.
What is the SMILES notation for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane?
The canonical SMILES for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane is C1CCOCC1.Cc1csc(NC(=O)c2cc(=O)cc(C)[nH]2)n1.
What is the InChIKey of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane?
The InChIKey is KPYJHRPKQYLQOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S.C5H10O/c1-6-3-8(15)4-9(12-6)10(16)14-11-13-7(2)5-17-11;1-2-4-6-5-3-1/h3-5H,1-2H3,(H,12,15)(H,13,14,16);1-5H2.
What are the key properties of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane?
6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane has a molecular weight of 335.43 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-oxo-1H-pyridine-2-carboxamide;oxane is sourced from PubChem (CID 144986620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).