C30H43F2OS2+ — CID 144989069
3-cyclohexyl-1,1-difluoropropane-1-thiol;1-[4-(cyclohexylmethoxy)naphthalen-1-yl]thiolan-1-ium (PubChem CID 144989069) has the molecular formula C30H43F2OS2+ and a molecular weight of 521.80 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-difluoropropane-1-thiol;1-[4-(cyclohexylmethoxy)naphthalen-1-yl]thiolan-1-ium.
| Compound Name | 3-cyclohexyl-1,1-difluoropropane-1-thiol;1-[4-(cyclohexylmethoxy)naphthalen-1-yl]thiolan-1-ium |
|---|---|
| PubChem CID | 144989069 |
| Molecular Formula | C30H43F2OS2+ |
| Molecular Weight | 521.80 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 3-cyclohexyl-1,1-difluoropropane-1-thiol;1-[4-(cyclohexylmethoxy)naphthalen-1-yl]thiolan-1-ium |
| SMILES | FC(F)(S)CCC1CCCCC1.c1ccc2c([S+]3CCCC3)ccc(OCC3CCCCC3)c2c1 |
| InChI | InChI=1S/C21H27OS.C9H16F2S/c1-2-8-17(9-3-1)16-22-20-12-13-21(23-14-6-7-15-23)19-11-5-4-10-18(19)20;10-9(11,12)7-6-8-4-2-1-3-5-8/h4-5,10-13,17H,1-3,6-9,14-16H2;8,12H,1-7H2/q+1; |
| InChIKey | MKFOSYFBRGEAQO-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.80 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|